Product name	Ethyl lactate
CAS RN	687-47-8
Assay	99%
Alias	Lactic acid ethyl ester; Propanoic acid, 2-hydroxy-, ethyl ester; ethyl 2-hydroxypropanoate; ethyl (2R)-2-hydroxypropanoate; Dl-Ethyl Lactate
EINECS No.	211-694-1
Molecular formula	C5H10O3
Molecular weight	118.1311
InChI	InChI=1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3
Density	1.05g/cm3
Melting point	-26℃
Boiling point	154.5°C at 760 mmHg
Flash point	54.6°C
Solubility	SOLUBLE
Properties	Colorless transparent liquid, with strong liquor odor.
Melting point	-25℃
Boiling point	154.2℃
Relative density	1.0302
Refractive index	1.4124
Flash point	96℃
Solubility	Easily soluble in ethyl alcohol and diethyl ether, soluble in water.

【Previous： Potassium borohydride 】 【 Next：Ethyl lactate 】 【Return】